About N,N-dimethyloctan-1-amine;trihydrochloride
N,N-dimethyloctan-1-amine;trihydrochloride (PubChem CID 172784847) has the molecular formula C10H26Cl3N
and a molecular weight of 266.68 g/mol. Its IUPAC name is N,N-dimethyloctan-1-amine;trihydrochloride.
Molecular Properties
| Compound Name | N,N-dimethyloctan-1-amine;trihydrochloride |
| PubChem CID | 172784847 |
| Molecular Formula | C10H26Cl3N |
| Molecular Weight | 266.68 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | N,N-dimethyloctan-1-amine;trihydrochloride |
| SMILES | CCCCCCCCN(C)C.Cl.Cl.Cl |
| InChI | InChI=1S/C10H23N.3ClH/c1-4-5-6-7-8-9-10-11(2)3;;;/h4-10H2,1-3H3;3*1H |
| InChIKey | OTEZIDXNAFJOTO-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.68 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethyloctan-1-amine;trihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyloctan-1-amine;trihydrochloride?
The IUPAC name of N,N-dimethyloctan-1-amine;trihydrochloride (CID 172784847) is N,N-dimethyloctan-1-amine;trihydrochloride.
What is the SMILES notation for N,N-dimethyloctan-1-amine;trihydrochloride?
The canonical SMILES for N,N-dimethyloctan-1-amine;trihydrochloride is CCCCCCCCN(C)C.Cl.Cl.Cl.
What is the InChIKey of N,N-dimethyloctan-1-amine;trihydrochloride?
The InChIKey is OTEZIDXNAFJOTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H23N.3ClH/c1-4-5-6-7-8-9-10-11(2)3;;;/h4-10H2,1-3H3;3*1H.
What are the key properties of N,N-dimethyloctan-1-amine;trihydrochloride?
N,N-dimethyloctan-1-amine;trihydrochloride has a molecular weight of 266.68 g/mol, XLogP of 4.17, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyloctan-1-amine;trihydrochloride is sourced from PubChem (CID 172784847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).