About azane;N,N-dimethyltetradecan-1-amine
azane;N,N-dimethyltetradecan-1-amine (PubChem CID 175798772) has the molecular formula C16H38N2
and a molecular weight of 258.49 g/mol. Its IUPAC name is azane;N,N-dimethyltetradecan-1-amine.
Molecular Properties
| Compound Name | azane;N,N-dimethyltetradecan-1-amine |
| PubChem CID | 175798772 |
| Molecular Formula | C16H38N2 |
| Molecular Weight | 258.49 g/mol |
| Exact Mass | 258.30 |
| IUPAC Name | azane;N,N-dimethyltetradecan-1-amine |
| SMILES | CCCCCCCCCCCCCCN(C)C.N |
| InChI | InChI=1S/C16H35N.H3N/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17(2)3;/h4-16H2,1-3H3;1H3 |
| InChIKey | FRJKSSRYAYPEGU-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 38.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 258.49 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze azane;N,N-dimethyltetradecan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;N,N-dimethyltetradecan-1-amine?
The IUPAC name of azane;N,N-dimethyltetradecan-1-amine (CID 175798772) is azane;N,N-dimethyltetradecan-1-amine.
What is the SMILES notation for azane;N,N-dimethyltetradecan-1-amine?
The canonical SMILES for azane;N,N-dimethyltetradecan-1-amine is CCCCCCCCCCCCCCN(C)C.N.
What is the InChIKey of azane;N,N-dimethyltetradecan-1-amine?
The InChIKey is FRJKSSRYAYPEGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H35N.H3N/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17(2)3;/h4-16H2,1-3H3;1H3.
What are the key properties of azane;N,N-dimethyltetradecan-1-amine?
azane;N,N-dimethyltetradecan-1-amine has a molecular weight of 258.49 g/mol, XLogP of 5.41, 13 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azane;N,N-dimethyltetradecan-1-amine is sourced from PubChem (CID 175798772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).