About N,N-dimethyldodecan-1-amine;hypobromous acid
N,N-dimethyldodecan-1-amine;hypobromous acid (PubChem CID 175692920) has the molecular formula C14H32BrNO
and a molecular weight of 310.32 g/mol. Its IUPAC name is N,N-dimethyldodecan-1-amine;hypobromous acid.
Molecular Properties
| Compound Name | N,N-dimethyldodecan-1-amine;hypobromous acid |
| PubChem CID | 175692920 |
| Molecular Formula | C14H32BrNO |
| Molecular Weight | 310.32 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | N,N-dimethyldodecan-1-amine;hypobromous acid |
| SMILES | CCCCCCCCCCCCN(C)C.OBr |
| InChI | InChI=1S/C14H31N.BrHO/c1-4-5-6-7-8-9-10-11-12-13-14-15(2)3;1-2/h4-14H2,1-3H3;2H |
| InChIKey | SSKOCBYZXZGMQS-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.32 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethyldodecan-1-amine;hypobromous acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyldodecan-1-amine;hypobromous acid?
The IUPAC name of N,N-dimethyldodecan-1-amine;hypobromous acid (CID 175692920) is N,N-dimethyldodecan-1-amine;hypobromous acid.
What is the SMILES notation for N,N-dimethyldodecan-1-amine;hypobromous acid?
The canonical SMILES for N,N-dimethyldodecan-1-amine;hypobromous acid is CCCCCCCCCCCCN(C)C.OBr.
What is the InChIKey of N,N-dimethyldodecan-1-amine;hypobromous acid?
The InChIKey is SSKOCBYZXZGMQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H31N.BrHO/c1-4-5-6-7-8-9-10-11-12-13-14-15(2)3;1-2/h4-14H2,1-3H3;2H.
What are the key properties of N,N-dimethyldodecan-1-amine;hypobromous acid?
N,N-dimethyldodecan-1-amine;hypobromous acid has a molecular weight of 310.32 g/mol, XLogP of 4.76, 11 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyldodecan-1-amine;hypobromous acid is sourced from PubChem (CID 175692920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).