C13H29NO3 — CID 174565539
carbonic acid;N,N-dimethyldecan-1-amine (PubChem CID 174565539) has the molecular formula C13H29NO3 and a molecular weight of 247.38 g/mol. Its IUPAC name is carbonic acid;N,N-dimethyldecan-1-amine.
| Compound Name | carbonic acid;N,N-dimethyldecan-1-amine |
|---|---|
| PubChem CID | 174565539 |
| Molecular Formula | C13H29NO3 |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.21 |
| IUPAC Name | carbonic acid;N,N-dimethyldecan-1-amine |
| SMILES | CCCCCCCCCCN(C)C.O=C(O)O |
| InChI | InChI=1S/C12H27N.CH2O3/c1-4-5-6-7-8-9-10-11-12-13(2)3;2-1(3)4/h4-12H2,1-3H3;(H2,2,3,4) |
| InChIKey | AJMSKIVUTAGBBS-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|