About N,N-dimethyldodecan-1-amine;phosphane
N,N-dimethyldodecan-1-amine;phosphane (PubChem CID 157284001) has the molecular formula C14H34NP
and a molecular weight of 247.41 g/mol. Its IUPAC name is N,N-dimethyldodecan-1-amine;phosphane.
Molecular Properties
| Compound Name | N,N-dimethyldodecan-1-amine;phosphane |
| PubChem CID | 157284001 |
| Molecular Formula | C14H34NP |
| Molecular Weight | 247.41 g/mol |
| Exact Mass | 247.24 |
| IUPAC Name | N,N-dimethyldodecan-1-amine;phosphane |
| SMILES | CCCCCCCCCCCCN(C)C.P |
| InChI | InChI=1S/C14H31N.H3P/c1-4-5-6-7-8-9-10-11-12-13-14-15(2)3;/h4-14H2,1-3H3;1H3 |
| InChIKey | PADOSDWKJNOZCK-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.41 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethyldodecan-1-amine;phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyldodecan-1-amine;phosphane?
The IUPAC name of N,N-dimethyldodecan-1-amine;phosphane (CID 157284001) is N,N-dimethyldodecan-1-amine;phosphane.
What is the SMILES notation for N,N-dimethyldodecan-1-amine;phosphane?
The canonical SMILES for N,N-dimethyldodecan-1-amine;phosphane is CCCCCCCCCCCCN(C)C.P.
What is the InChIKey of N,N-dimethyldodecan-1-amine;phosphane?
The InChIKey is PADOSDWKJNOZCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H31N.H3P/c1-4-5-6-7-8-9-10-11-12-13-14-15(2)3;/h4-14H2,1-3H3;1H3.
What are the key properties of N,N-dimethyldodecan-1-amine;phosphane?
N,N-dimethyldodecan-1-amine;phosphane has a molecular weight of 247.41 g/mol, XLogP of 4.53, 11 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyldodecan-1-amine;phosphane is sourced from PubChem (CID 157284001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).