C37H75NO4S — CID 121330534
(Z)-N-methyl-N-[(Z)-octadec-9-enyl]octadec-9-en-1-amine;sulfuric acid (PubChem CID 121330534) has the molecular formula C37H75NO4S and a molecular weight of 630.08 g/mol. Its IUPAC name is (Z)-N-methyl-N-[(Z)-octadec-9-enyl]octadec-9-en-1-amine;sulfuric acid.
| Compound Name | (Z)-N-methyl-N-[(Z)-octadec-9-enyl]octadec-9-en-1-amine;sulfuric acid |
|---|---|
| PubChem CID | 121330534 |
| Molecular Formula | C37H75NO4S |
| Molecular Weight | 630.08 g/mol |
| Exact Mass | 629.54 |
| IUPAC Name | (Z)-N-methyl-N-[(Z)-octadec-9-enyl]octadec-9-en-1-amine;sulfuric acid |
| SMILES | CCCCCCCC/C=C\CCCCCCCCN(C)CCCCCCCC/C=C\CCCCCCCC.O=S(=O)(O)O |
| InChI | InChI=1S/C37H73N.H2O4S/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-38(3)37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2;1-5(2,3)4/h18-21H,4-17,22-37H2,1-3H3;(H2,1,2,3,4)/b20-18-,21-19-; |
| InChIKey | CSSIWLBZVKSSPN-YIQDKWKASA-N |
| XLogP | 12.34 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.08 |
| LogP ≤ 5 | 12.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|