C21H43NNaO3S — CID 170843362
CID 170843362 (PubChem CID 170843362) has the molecular formula C21H43NNaO3S and a molecular weight of 412.64 g/mol.
| Compound Name | CID 170843362 |
|---|---|
| PubChem CID | 170843362 |
| Molecular Formula | C21H43NNaO3S |
| Molecular Weight | 412.64 g/mol |
| Exact Mass | 412.29 |
| IUPAC Name | — |
| SMILES | CCCCCCCCC=CCCCCCCCCN(C)CCS(=O)(=O)O.[Na] |
| InChI | InChI=1S/C21H43NO3S.Na/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22(2)20-21-26(23,24)25;/h10-11H,3-9,12-21H2,1-2H3,(H,23,24,25); |
| InChIKey | GXZNTTXRLVVXRJ-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.64 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|