C24H47NO3S — CID 173463847
2-[but-2-enyl(octadec-9-enyl)amino]ethanesulfonic acid (PubChem CID 173463847) has the molecular formula C24H47NO3S and a molecular weight of 429.71 g/mol. Its IUPAC name is 2-[but-2-enyl(octadec-9-enyl)amino]ethanesulfonic acid.
| Compound Name | 2-[but-2-enyl(octadec-9-enyl)amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 173463847 |
| Molecular Formula | C24H47NO3S |
| Molecular Weight | 429.71 g/mol |
| Exact Mass | 429.33 |
| IUPAC Name | 2-[but-2-enyl(octadec-9-enyl)amino]ethanesulfonic acid |
| SMILES | CC=CCN(CCCCCCCCC=CCCCCCCCC)CCS(=O)(=O)O |
| InChI | InChI=1S/C24H47NO3S/c1-3-5-7-8-9-10-11-12-13-14-15-16-17-18-19-20-22-25(21-6-4-2)23-24-29(26,27)28/h4,6,12-13H,3,5,7-11,14-24H2,1-2H3,(H,26,27,28) |
| InChIKey | AFGOCYOVJVEBFL-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.71 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|