About lithium;N-[(E)-but-2-enyl]-N-octyloctan-1-amine;hydride
lithium;N-[(E)-but-2-enyl]-N-octyloctan-1-amine;hydride (PubChem CID 174719657) has the molecular formula C20H42LiN
and a molecular weight of 303.50 g/mol. Its IUPAC name is lithium;N-[(E)-but-2-enyl]-N-octyloctan-1-amine;hydride.
Molecular Properties
| Compound Name | lithium;N-[(E)-but-2-enyl]-N-octyloctan-1-amine;hydride |
| PubChem CID | 174719657 |
| Molecular Formula | C20H42LiN |
| Molecular Weight | 303.50 g/mol |
| Exact Mass | 303.35 |
| IUPAC Name | lithium;N-[(E)-but-2-enyl]-N-octyloctan-1-amine;hydride |
| SMILES | C/C=C/CN(CCCCCCCC)CCCCCCCC.[H-].[Li+] |
| InChI | InChI=1S/C20H41N.Li.H/c1-4-7-10-12-14-16-19-21(18-9-6-3)20-17-15-13-11-8-5-2;;/h6,9H,4-5,7-8,10-20H2,1-3H3;;/q;+1;-1/b9-6+;; |
| InChIKey | KPGQUCRXZVOTIF-SWSRPJROSA-N |
| XLogP | 3.70 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.50 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze lithium;N-[(E)-but-2-enyl]-N-octyloctan-1-amine;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;N-[(E)-but-2-enyl]-N-octyloctan-1-amine;hydride?
The IUPAC name of lithium;N-[(E)-but-2-enyl]-N-octyloctan-1-amine;hydride (CID 174719657) is lithium;N-[(E)-but-2-enyl]-N-octyloctan-1-amine;hydride.
What is the SMILES notation for lithium;N-[(E)-but-2-enyl]-N-octyloctan-1-amine;hydride?
The canonical SMILES for lithium;N-[(E)-but-2-enyl]-N-octyloctan-1-amine;hydride is C/C=C/CN(CCCCCCCC)CCCCCCCC.[H-].[Li+].
What is the InChIKey of lithium;N-[(E)-but-2-enyl]-N-octyloctan-1-amine;hydride?
The InChIKey is KPGQUCRXZVOTIF-SWSRPJROSA-N. The full InChI is InChI=1S/C20H41N.Li.H/c1-4-7-10-12-14-16-19-21(18-9-6-3)20-17-15-13-11-8-5-2;;/h6,9H,4-5,7-8,10-20H2,1-3H3;;/q;+1;-1/b9-6+;;.
What are the key properties of lithium;N-[(E)-but-2-enyl]-N-octyloctan-1-amine;hydride?
lithium;N-[(E)-but-2-enyl]-N-octyloctan-1-amine;hydride has a molecular weight of 303.50 g/mol, XLogP of 3.70, 16 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;N-[(E)-but-2-enyl]-N-octyloctan-1-amine;hydride is sourced from PubChem (CID 174719657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).