C21H44KNO3S — CID 173121917
potassium;hydride;2-[methyl-[(Z)-octadec-9-enyl]amino]ethanesulfonic acid (PubChem CID 173121917) has the molecular formula C21H44KNO3S and a molecular weight of 429.75 g/mol. Its IUPAC name is potassium;hydride;2-[methyl-[(Z)-octadec-9-enyl]amino]ethanesulfonic acid.
| Compound Name | potassium;hydride;2-[methyl-[(Z)-octadec-9-enyl]amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 173121917 |
| Molecular Formula | C21H44KNO3S |
| Molecular Weight | 429.75 g/mol |
| Exact Mass | 429.27 |
| IUPAC Name | potassium;hydride;2-[methyl-[(Z)-octadec-9-enyl]amino]ethanesulfonic acid |
| SMILES | CCCCCCCC/C=C\CCCCCCCCN(C)CCS(=O)(=O)O.[H-].[K+] |
| InChI | InChI=1S/C21H43NO3S.K.H/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22(2)20-21-26(23,24)25;;/h10-11H,3-9,12-21H2,1-2H3,(H,23,24,25);;/q;+1;-1/b11-10-;; |
| InChIKey | WXWMFBQYKSSDFJ-PQBRBDCOSA-N |
| XLogP | 2.96 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.75 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|