About sodium;hydride;(Z)-octadec-9-ene-1-sulfonic acid
sodium;hydride;(Z)-octadec-9-ene-1-sulfonic acid (PubChem CID 173328346) has the molecular formula C18H37NaO3S
and a molecular weight of 356.55 g/mol. Its IUPAC name is sodium;hydride;(Z)-octadec-9-ene-1-sulfonic acid.
Molecular Properties
| Compound Name | sodium;hydride;(Z)-octadec-9-ene-1-sulfonic acid |
| PubChem CID | 173328346 |
| Molecular Formula | C18H37NaO3S |
| Molecular Weight | 356.55 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | sodium;hydride;(Z)-octadec-9-ene-1-sulfonic acid |
| SMILES | CCCCCCCC/C=C\CCCCCCCCS(=O)(=O)O.[H-].[Na+] |
| InChI | InChI=1S/C18H36O3S.Na.H/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-22(19,20)21;;/h9-10H,2-8,11-18H2,1H3,(H,19,20,21);;/q;+1;-1/b10-9-;; |
| InChIKey | BRXWGAADGRRZNW-XXAVUKJNSA-N |
| XLogP | 3.03 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.55 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;(Z)-octadec-9-ene-1-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;(Z)-octadec-9-ene-1-sulfonic acid?
The IUPAC name of sodium;hydride;(Z)-octadec-9-ene-1-sulfonic acid (CID 173328346) is sodium;hydride;(Z)-octadec-9-ene-1-sulfonic acid.
What is the SMILES notation for sodium;hydride;(Z)-octadec-9-ene-1-sulfonic acid?
The canonical SMILES for sodium;hydride;(Z)-octadec-9-ene-1-sulfonic acid is CCCCCCCC/C=C\CCCCCCCCS(=O)(=O)O.[H-].[Na+].
What is the InChIKey of sodium;hydride;(Z)-octadec-9-ene-1-sulfonic acid?
The InChIKey is BRXWGAADGRRZNW-XXAVUKJNSA-N. The full InChI is InChI=1S/C18H36O3S.Na.H/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-22(19,20)21;;/h9-10H,2-8,11-18H2,1H3,(H,19,20,21);;/q;+1;-1/b10-9-;;.
What are the key properties of sodium;hydride;(Z)-octadec-9-ene-1-sulfonic acid?
sodium;hydride;(Z)-octadec-9-ene-1-sulfonic acid has a molecular weight of 356.55 g/mol, XLogP of 3.03, 16 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;(Z)-octadec-9-ene-1-sulfonic acid is sourced from PubChem (CID 173328346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).