C52H104Br2N4O2 — CID 172726509
(Z)-N-[4-[methyl-[7-[methyl-[3-[[(Z)-octadec-9-enoyl]amino]propyl]amino]heptyl]amino]butyl]octadec-9-enamide;dihydrobromide (PubChem CID 172726509) has the molecular formula C52H104Br2N4O2 and a molecular weight of 977.24 g/mol. Its IUPAC name is (Z)-N-[4-[methyl-[7-[methyl-[3-[[(Z)-octadec-9-enoyl]amino]propyl]amino]heptyl]amino]butyl]octadec-9-enamide;dihydrobromide.
| Compound Name | (Z)-N-[4-[methyl-[7-[methyl-[3-[[(Z)-octadec-9-enoyl]amino]propyl]amino]heptyl]amino]butyl]octadec-9-enamide;dihydrobromide |
|---|---|
| PubChem CID | 172726509 |
| Molecular Formula | C52H104Br2N4O2 |
| Molecular Weight | 977.24 g/mol |
| Exact Mass | 974.65 |
| IUPAC Name | (Z)-N-[4-[methyl-[7-[methyl-[3-[[(Z)-octadec-9-enoyl]amino]propyl]amino]heptyl]amino]butyl]octadec-9-enamide;dihydrobromide |
| SMILES | Br.Br.CCCCCCCC/C=C\CCCCCCCC(=O)NCCCCN(C)CCCCCCCN(C)CCCNC(=O)CCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C52H102N4O2.2BrH/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-32-36-43-51(57)53-45-38-41-49-55(3)47-39-34-31-35-40-48-56(4)50-42-46-54-52(58)44-37-33-30-28-26-24-22-20-18-16-14-12-10-8-6-2;;/h19-22H,5-18,23-50H2,1-4H3,(H,53,57)(H,54,58);2*1H/b21-19-,22-20-;; |
| InChIKey | HFIMPMOWPVBLOJ-ZEUFFFBISA-N |
| XLogP | 15.43 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 47 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 977.24 |
| LogP ≤ 5 | 15.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|