C50H98Br2N4O2 — CID 175897161
(Z)-N-[4-[methyl-[5-[methyl-[3-[[(E)-octadec-9-enoyl]amino]propyl]amino]pent-2-enyl]amino]butyl]octadec-9-enamide;dihydrobromide (PubChem CID 175897161) has the molecular formula C50H98Br2N4O2 and a molecular weight of 947.17 g/mol. Its IUPAC name is (Z)-N-[4-[methyl-[5-[methyl-[3-[[(E)-octadec-9-enoyl]amino]propyl]amino]pent-2-enyl]amino]butyl]octadec-9-enamide;dihydrobromide.
| Compound Name | (Z)-N-[4-[methyl-[5-[methyl-[3-[[(E)-octadec-9-enoyl]amino]propyl]amino]pent-2-enyl]amino]butyl]octadec-9-enamide;dihydrobromide |
|---|---|
| PubChem CID | 175897161 |
| Molecular Formula | C50H98Br2N4O2 |
| Molecular Weight | 947.17 g/mol |
| Exact Mass | 944.61 |
| IUPAC Name | (Z)-N-[4-[methyl-[5-[methyl-[3-[[(E)-octadec-9-enoyl]amino]propyl]amino]pent-2-enyl]amino]butyl]octadec-9-enamide;dihydrobromide |
| SMILES | Br.Br.CCCCCCCC/C=C\CCCCCCCC(=O)NCCCCN(C)CC=CCCN(C)CCCNC(=O)CCCCCCC/C=C/CCCCCCCC |
| InChI | InChI=1S/C50H96N4O2.2BrH/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-34-41-49(55)51-43-36-39-47-53(3)45-37-33-38-46-54(4)48-40-44-52-50(56)42-35-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2;;/h19-22,33,37H,5-18,23-32,34-36,38-48H2,1-4H3,(H,51,55)(H,52,56);2*1H/b21-19-,22-20+,37-33?;; |
| InChIKey | YBYIOSCMWHZFIQ-AXHMLOBOSA-N |
| XLogP | 14.43 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 947.17 |
| LogP ≤ 5 | 14.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|