C27H53N3O2 — CID 154225120
N-[3-[3-acetamidopropyl(methyl)amino]propyl]octadec-9-enamide (PubChem CID 154225120) has the molecular formula C27H53N3O2 and a molecular weight of 451.74 g/mol. Its IUPAC name is N-[3-[3-acetamidopropyl(methyl)amino]propyl]octadec-9-enamide.
| Compound Name | N-[3-[3-acetamidopropyl(methyl)amino]propyl]octadec-9-enamide |
|---|---|
| PubChem CID | 154225120 |
| Molecular Formula | C27H53N3O2 |
| Molecular Weight | 451.74 g/mol |
| Exact Mass | 451.41 |
| IUPAC Name | N-[3-[3-acetamidopropyl(methyl)amino]propyl]octadec-9-enamide |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)NCCCN(C)CCCNC(C)=O |
| InChI | InChI=1S/C27H53N3O2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-21-27(32)29-23-20-25-30(3)24-19-22-28-26(2)31/h11-12H,4-10,13-25H2,1-3H3,(H,28,31)(H,29,32) |
| InChIKey | OXBRMIJLMDSSHI-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.74 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|