C22H46ClNO — CID 121437265
1-chloroethanol;(Z)-N,N-dimethyloctadec-9-en-1-amine (PubChem CID 121437265) has the molecular formula C22H46ClNO and a molecular weight of 376.07 g/mol. Its IUPAC name is 1-chloroethanol;(Z)-N,N-dimethyloctadec-9-en-1-amine.
| Compound Name | 1-chloroethanol;(Z)-N,N-dimethyloctadec-9-en-1-amine |
|---|---|
| PubChem CID | 121437265 |
| Molecular Formula | C22H46ClNO |
| Molecular Weight | 376.07 g/mol |
| Exact Mass | 375.33 |
| IUPAC Name | 1-chloroethanol;(Z)-N,N-dimethyloctadec-9-en-1-amine |
| SMILES | CC(O)Cl.CCCCCCCC/C=C\CCCCCCCCN(C)C |
| InChI | InChI=1S/C20H41N.C2H5ClO/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21(2)3;1-2(3)4/h11-12H,4-10,13-20H2,1-3H3;2,4H,1H3/b12-11-; |
| InChIKey | OASJAKXLDPOPPT-AFEZEDKISA-N |
| XLogP | 7.15 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.07 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|