C18H37N — CID 102116363
(E)-N,N-dimethylhexadec-10-en-1-amine (PubChem CID 102116363) has the molecular formula C18H37N and a molecular weight of 267.50 g/mol. Its IUPAC name is (E)-N,N-dimethylhexadec-10-en-1-amine.
| Compound Name | (E)-N,N-dimethylhexadec-10-en-1-amine |
|---|---|
| PubChem CID | 102116363 |
| Molecular Formula | C18H37N |
| Molecular Weight | 267.50 g/mol |
| Exact Mass | 267.29 |
| IUPAC Name | (E)-N,N-dimethylhexadec-10-en-1-amine |
| SMILES | CCCCC/C=C/CCCCCCCCCN(C)C |
| InChI | InChI=1S/C18H37N/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(2)3/h8-9H,4-7,10-18H2,1-3H3/b9-8+ |
| InChIKey | NXQAKLWBQMQUKU-CMDGGOBGSA-N |
| XLogP | 5.81 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.50 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|