C19H40ClN — CID 173393546
N,N-dimethylheptadec-3-en-1-amine;hydrochloride (PubChem CID 173393546) has the molecular formula C19H40ClN and a molecular weight of 317.99 g/mol. Its IUPAC name is N,N-dimethylheptadec-3-en-1-amine;hydrochloride.
| Compound Name | N,N-dimethylheptadec-3-en-1-amine;hydrochloride |
|---|---|
| PubChem CID | 173393546 |
| Molecular Formula | C19H40ClN |
| Molecular Weight | 317.99 g/mol |
| Exact Mass | 317.28 |
| IUPAC Name | N,N-dimethylheptadec-3-en-1-amine;hydrochloride |
| SMILES | CCCCCCCCCCCCCC=CCCN(C)C.Cl |
| InChI | InChI=1S/C19H39N.ClH/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(2)3;/h16-17H,4-15,18-19H2,1-3H3;1H |
| InChIKey | OUCWVOOIAVHTQT-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.99 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|