C32H59NO3S — CID 146593126
N,N-dioctyloctan-1-amine;4-ethenylbenzenesulfonic acid (PubChem CID 146593126) has the molecular formula C32H59NO3S and a molecular weight of 537.90 g/mol. Its IUPAC name is N,N-dioctyloctan-1-amine;4-ethenylbenzenesulfonic acid.
| Compound Name | N,N-dioctyloctan-1-amine;4-ethenylbenzenesulfonic acid |
|---|---|
| PubChem CID | 146593126 |
| Molecular Formula | C32H59NO3S |
| Molecular Weight | 537.90 g/mol |
| Exact Mass | 537.42 |
| IUPAC Name | N,N-dioctyloctan-1-amine;4-ethenylbenzenesulfonic acid |
| SMILES | C=Cc1ccc(S(=O)(=O)O)cc1.CCCCCCCCN(CCCCCCCC)CCCCCCCC |
| InChI | InChI=1S/C24H51N.C8H8O3S/c1-4-7-10-13-16-19-22-25(23-20-17-14-11-8-5-2)24-21-18-15-12-9-6-3;1-2-7-3-5-8(6-4-7)12(9,10)11/h4-24H2,1-3H3;2-6H,1H2,(H,9,10,11) |
| InChIKey | XRIMHSBAFPKEPB-UHFFFAOYSA-N |
| XLogP | 9.95 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.90 |
| LogP ≤ 5 | 9.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|