About 4-ethenylbenzenesulfonic acid;1-ethenyl-3-hexadecyl-2H-imidazole
4-ethenylbenzenesulfonic acid;1-ethenyl-3-hexadecyl-2H-imidazole (PubChem CID 175397953) has the molecular formula C29H48N2O3S
and a molecular weight of 504.78 g/mol. Its IUPAC name is 4-ethenylbenzenesulfonic acid;1-ethenyl-3-hexadecyl-2H-imidazole.
Molecular Properties
| Compound Name | 4-ethenylbenzenesulfonic acid;1-ethenyl-3-hexadecyl-2H-imidazole |
| PubChem CID | 175397953 |
| Molecular Formula | C29H48N2O3S |
| Molecular Weight | 504.78 g/mol |
| Exact Mass | 504.34 |
| IUPAC Name | 4-ethenylbenzenesulfonic acid;1-ethenyl-3-hexadecyl-2H-imidazole |
| SMILES | C=CN1C=CN(CCCCCCCCCCCCCCCC)C1.C=Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C21H40N2.C8H8O3S/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-23-20-19-22(4-2)21-23;1-2-7-3-5-8(6-4-7)12(9,10)11/h4,19-20H,2-3,5-18,21H2,1H3;2-6H,1H2,(H,9,10,11) |
| InChIKey | ZWWHELWGTHGEMK-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 504.78 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 4-ethenylbenzenesulfonic acid;1-ethenyl-3-hexadecyl-2H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethenylbenzenesulfonic acid;1-ethenyl-3-hexadecyl-2H-imidazole?
The IUPAC name of 4-ethenylbenzenesulfonic acid;1-ethenyl-3-hexadecyl-2H-imidazole (CID 175397953) is 4-ethenylbenzenesulfonic acid;1-ethenyl-3-hexadecyl-2H-imidazole.
What is the SMILES notation for 4-ethenylbenzenesulfonic acid;1-ethenyl-3-hexadecyl-2H-imidazole?
The canonical SMILES for 4-ethenylbenzenesulfonic acid;1-ethenyl-3-hexadecyl-2H-imidazole is C=CN1C=CN(CCCCCCCCCCCCCCCC)C1.C=Cc1ccc(S(=O)(=O)O)cc1.
What is the InChIKey of 4-ethenylbenzenesulfonic acid;1-ethenyl-3-hexadecyl-2H-imidazole?
The InChIKey is ZWWHELWGTHGEMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H40N2.C8H8O3S/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-23-20-19-22(4-2)21-23;1-2-7-3-5-8(6-4-7)12(9,10)11/h4,19-20H,2-3,5-18,21H2,1H3;2-6H,1H2,(H,9,10,11).
What are the key properties of 4-ethenylbenzenesulfonic acid;1-ethenyl-3-hexadecyl-2H-imidazole?
4-ethenylbenzenesulfonic acid;1-ethenyl-3-hexadecyl-2H-imidazole has a molecular weight of 504.78 g/mol, XLogP of 8.23, 18 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethenylbenzenesulfonic acid;1-ethenyl-3-hexadecyl-2H-imidazole is sourced from PubChem (CID 175397953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).