C21H44N2O3S — CID 174775382
1-hexadecyl-3-methyl-2H-imidazole;methanesulfonic acid (PubChem CID 174775382) has the molecular formula C21H44N2O3S and a molecular weight of 404.66 g/mol. Its IUPAC name is 1-hexadecyl-3-methyl-2H-imidazole;methanesulfonic acid.
| Compound Name | 1-hexadecyl-3-methyl-2H-imidazole;methanesulfonic acid |
|---|---|
| PubChem CID | 174775382 |
| Molecular Formula | C21H44N2O3S |
| Molecular Weight | 404.66 g/mol |
| Exact Mass | 404.31 |
| IUPAC Name | 1-hexadecyl-3-methyl-2H-imidazole;methanesulfonic acid |
| SMILES | CCCCCCCCCCCCCCCCN1C=CN(C)C1.CS(=O)(=O)O |
| InChI | InChI=1S/C20H40N2.CH4O3S/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-22-19-18-21(2)20-22;1-5(2,3)4/h18-19H,3-17,20H2,1-2H3;1H3,(H,2,3,4) |
| InChIKey | FEIVOTAKULUZJW-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.66 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|