About 1-dodecyl-3-methyl-2H-imidazole;N-fluorosulfamoyl fluoride
1-dodecyl-3-methyl-2H-imidazole;N-fluorosulfamoyl fluoride (PubChem CID 175445474) has the molecular formula C16H33F2N3O2S
and a molecular weight of 369.52 g/mol. Its IUPAC name is 1-dodecyl-3-methyl-2H-imidazole;N-fluorosulfamoyl fluoride.
Molecular Properties
| Compound Name | 1-dodecyl-3-methyl-2H-imidazole;N-fluorosulfamoyl fluoride |
| PubChem CID | 175445474 |
| Molecular Formula | C16H33F2N3O2S |
| Molecular Weight | 369.52 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | 1-dodecyl-3-methyl-2H-imidazole;N-fluorosulfamoyl fluoride |
| SMILES | CCCCCCCCCCCCN1C=CN(C)C1.O=S(=O)(F)NF |
| InChI | InChI=1S/C16H32N2.F2HNO2S/c1-3-4-5-6-7-8-9-10-11-12-13-18-15-14-17(2)16-18;1-3-6(2,4)5/h14-15H,3-13,16H2,1-2H3;3H |
| InChIKey | IYUJCGPENFISPB-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.52 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-dodecyl-3-methyl-2H-imidazole;N-fluorosulfamoyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-dodecyl-3-methyl-2H-imidazole;N-fluorosulfamoyl fluoride?
The IUPAC name of 1-dodecyl-3-methyl-2H-imidazole;N-fluorosulfamoyl fluoride (CID 175445474) is 1-dodecyl-3-methyl-2H-imidazole;N-fluorosulfamoyl fluoride.
What is the SMILES notation for 1-dodecyl-3-methyl-2H-imidazole;N-fluorosulfamoyl fluoride?
The canonical SMILES for 1-dodecyl-3-methyl-2H-imidazole;N-fluorosulfamoyl fluoride is CCCCCCCCCCCCN1C=CN(C)C1.O=S(=O)(F)NF.
What is the InChIKey of 1-dodecyl-3-methyl-2H-imidazole;N-fluorosulfamoyl fluoride?
The InChIKey is IYUJCGPENFISPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32N2.F2HNO2S/c1-3-4-5-6-7-8-9-10-11-12-13-18-15-14-17(2)16-18;1-3-6(2,4)5/h14-15H,3-13,16H2,1-2H3;3H.
What are the key properties of 1-dodecyl-3-methyl-2H-imidazole;N-fluorosulfamoyl fluoride?
1-dodecyl-3-methyl-2H-imidazole;N-fluorosulfamoyl fluoride has a molecular weight of 369.52 g/mol, XLogP of 4.26, 12 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-dodecyl-3-methyl-2H-imidazole;N-fluorosulfamoyl fluoride is sourced from PubChem (CID 175445474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).