C17H26F6N2O2 — CID 160861168
1,1,1,5,5,5-hexafluoropentane-2,4-dione;1-methyl-3-octyl-2H-imidazole (PubChem CID 160861168) has the molecular formula C17H26F6N2O2 and a molecular weight of 404.40 g/mol. Its IUPAC name is 1,1,1,5,5,5-hexafluoropentane-2,4-dione;1-methyl-3-octyl-2H-imidazole.
| Compound Name | 1,1,1,5,5,5-hexafluoropentane-2,4-dione;1-methyl-3-octyl-2H-imidazole |
|---|---|
| PubChem CID | 160861168 |
| Molecular Formula | C17H26F6N2O2 |
| Molecular Weight | 404.40 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | 1,1,1,5,5,5-hexafluoropentane-2,4-dione;1-methyl-3-octyl-2H-imidazole |
| SMILES | CCCCCCCCN1C=CN(C)C1.O=C(CC(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H24N2.C5H2F6O2/c1-3-4-5-6-7-8-9-14-11-10-13(2)12-14;6-4(7,8)2(12)1-3(13)5(9,10)11/h10-11H,3-9,12H2,1-2H3;1H2 |
| InChIKey | SKMSHSZBLHNVRN-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.40 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|