C14H26F6N2O6S2 — CID 175946209
1-methyl-3-octyl-2H-imidazole;bis(trifluoromethanesulfonic acid) (PubChem CID 175946209) has the molecular formula C14H26F6N2O6S2 and a molecular weight of 496.49 g/mol. Its IUPAC name is 1-methyl-3-octyl-2H-imidazole;bis(trifluoromethanesulfonic acid).
| Compound Name | 1-methyl-3-octyl-2H-imidazole;bis(trifluoromethanesulfonic acid) |
|---|---|
| PubChem CID | 175946209 |
| Molecular Formula | C14H26F6N2O6S2 |
| Molecular Weight | 496.49 g/mol |
| Exact Mass | 496.11 |
| IUPAC Name | 1-methyl-3-octyl-2H-imidazole;bis(trifluoromethanesulfonic acid) |
| SMILES | CCCCCCCCN1C=CN(C)C1.O=S(=O)(O)C(F)(F)F.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C12H24N2.2CHF3O3S/c1-3-4-5-6-7-8-9-14-11-10-13(2)12-14;2*2-1(3,4)8(5,6)7/h10-11H,3-9,12H2,1-2H3;2*(H,5,6,7) |
| InChIKey | ZRULULLEHKLJTE-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 115.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.49 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|