C16H34N2O7S2 — CID 174593258
1-dodecyl-3-methyl-2H-imidazole;sulfo hydrogen sulfate (PubChem CID 174593258) has the molecular formula C16H34N2O7S2 and a molecular weight of 430.59 g/mol. Its IUPAC name is 1-dodecyl-3-methyl-2H-imidazole;sulfo hydrogen sulfate.
| Compound Name | 1-dodecyl-3-methyl-2H-imidazole;sulfo hydrogen sulfate |
|---|---|
| PubChem CID | 174593258 |
| Molecular Formula | C16H34N2O7S2 |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | 1-dodecyl-3-methyl-2H-imidazole;sulfo hydrogen sulfate |
| SMILES | CCCCCCCCCCCCN1C=CN(C)C1.O=S(=O)(O)OS(=O)(=O)O |
| InChI | InChI=1S/C16H32N2.H2O7S2/c1-3-4-5-6-7-8-9-10-11-12-13-18-15-14-17(2)16-18;1-8(2,3)7-9(4,5)6/h14-15H,3-13,16H2,1-2H3;(H,1,2,3)(H,4,5,6) |
| InChIKey | WSNPJGAXDJWHLY-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 124.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|