C15H32N4O4S — CID 175297657
1-butyl-3-methyl-2H-imidazole;1-ethyl-3-methyl-2H-imidazole;methyl hydrogen sulfate (PubChem CID 175297657) has the molecular formula C15H32N4O4S and a molecular weight of 364.51 g/mol. Its IUPAC name is 1-butyl-3-methyl-2H-imidazole;1-ethyl-3-methyl-2H-imidazole;methyl hydrogen sulfate.
| Compound Name | 1-butyl-3-methyl-2H-imidazole;1-ethyl-3-methyl-2H-imidazole;methyl hydrogen sulfate |
|---|---|
| PubChem CID | 175297657 |
| Molecular Formula | C15H32N4O4S |
| Molecular Weight | 364.51 g/mol |
| Exact Mass | 364.21 |
| IUPAC Name | 1-butyl-3-methyl-2H-imidazole;1-ethyl-3-methyl-2H-imidazole;methyl hydrogen sulfate |
| SMILES | CCCCN1C=CN(C)C1.CCN1C=CN(C)C1.COS(=O)(=O)O |
| InChI | InChI=1S/C8H16N2.C6H12N2.CH4O4S/c1-3-4-5-10-7-6-9(2)8-10;1-3-8-5-4-7(2)6-8;1-5-6(2,3)4/h6-7H,3-5,8H2,1-2H3;4-5H,3,6H2,1-2H3;1H3,(H,2,3,4) |
| InChIKey | RAXVPYLBQOCFHE-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 76.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.51 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|