About tripotassium;1-butyl-3-methyl-2H-imidazole;hydride
tripotassium;1-butyl-3-methyl-2H-imidazole;hydride (PubChem CID 174886963) has the molecular formula C8H19K3N2
and a molecular weight of 260.55 g/mol. Its IUPAC name is tripotassium;1-butyl-3-methyl-2H-imidazole;hydride.
Molecular Properties
| Compound Name | tripotassium;1-butyl-3-methyl-2H-imidazole;hydride |
| PubChem CID | 174886963 |
| Molecular Formula | C8H19K3N2 |
| Molecular Weight | 260.55 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | tripotassium;1-butyl-3-methyl-2H-imidazole;hydride |
| SMILES | CCCCN1C=CN(C)C1.[H-].[H-].[H-].[K+].[K+].[K+] |
| InChI | InChI=1S/C8H16N2.3K.3H/c1-3-4-5-10-7-6-9(2)8-10;;;;;;/h6-7H,3-5,8H2,1-2H3;;;;;;/q;3*+1;3*-1 |
| InChIKey | IUHSLORQNUUFAQ-UHFFFAOYSA-N |
| XLogP | -7.19 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.55 |
| LogP ≤ 5 | -7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze tripotassium;1-butyl-3-methyl-2H-imidazole;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tripotassium;1-butyl-3-methyl-2H-imidazole;hydride?
The IUPAC name of tripotassium;1-butyl-3-methyl-2H-imidazole;hydride (CID 174886963) is tripotassium;1-butyl-3-methyl-2H-imidazole;hydride.
What is the SMILES notation for tripotassium;1-butyl-3-methyl-2H-imidazole;hydride?
The canonical SMILES for tripotassium;1-butyl-3-methyl-2H-imidazole;hydride is CCCCN1C=CN(C)C1.[H-].[H-].[H-].[K+].[K+].[K+].
What is the InChIKey of tripotassium;1-butyl-3-methyl-2H-imidazole;hydride?
The InChIKey is IUHSLORQNUUFAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2.3K.3H/c1-3-4-5-10-7-6-9(2)8-10;;;;;;/h6-7H,3-5,8H2,1-2H3;;;;;;/q;3*+1;3*-1.
What are the key properties of tripotassium;1-butyl-3-methyl-2H-imidazole;hydride?
tripotassium;1-butyl-3-methyl-2H-imidazole;hydride has a molecular weight of 260.55 g/mol, XLogP of -7.19, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tripotassium;1-butyl-3-methyl-2H-imidazole;hydride is sourced from PubChem (CID 174886963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).