About 1-butyl-3-methyl-2H-imidazole;hydron;hexafluorophosphate
1-butyl-3-methyl-2H-imidazole;hydron;hexafluorophosphate (PubChem CID 174451662) has the molecular formula C8H17F6N2P
and a molecular weight of 286.20 g/mol. Its IUPAC name is 1-butyl-3-methyl-2H-imidazole;hydron;hexafluorophosphate.
Molecular Properties
| Compound Name | 1-butyl-3-methyl-2H-imidazole;hydron;hexafluorophosphate |
| PubChem CID | 174451662 |
| Molecular Formula | C8H17F6N2P |
| Molecular Weight | 286.20 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 1-butyl-3-methyl-2H-imidazole;hydron;hexafluorophosphate |
| SMILES | CCCCN1C=CN(C)C1.F[P-](F)(F)(F)(F)F.[H+] |
| InChI | InChI=1S/C8H16N2.F6P/c1-3-4-5-10-7-6-9(2)8-10;1-7(2,3,4,5)6/h6-7H,3-5,8H2,1-2H3;/q;-1/p+1 |
| InChIKey | ICTFLTJZPAXFBO-UHFFFAOYSA-O |
| XLogP | 4.96 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.20 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-butyl-3-methyl-2H-imidazole;hydron;hexafluorophosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-3-methyl-2H-imidazole;hydron;hexafluorophosphate?
The IUPAC name of 1-butyl-3-methyl-2H-imidazole;hydron;hexafluorophosphate (CID 174451662) is 1-butyl-3-methyl-2H-imidazole;hydron;hexafluorophosphate.
What is the SMILES notation for 1-butyl-3-methyl-2H-imidazole;hydron;hexafluorophosphate?
The canonical SMILES for 1-butyl-3-methyl-2H-imidazole;hydron;hexafluorophosphate is CCCCN1C=CN(C)C1.F[P-](F)(F)(F)(F)F.[H+].
What is the InChIKey of 1-butyl-3-methyl-2H-imidazole;hydron;hexafluorophosphate?
The InChIKey is ICTFLTJZPAXFBO-UHFFFAOYSA-O. The full InChI is InChI=1S/C8H16N2.F6P/c1-3-4-5-10-7-6-9(2)8-10;1-7(2,3,4,5)6/h6-7H,3-5,8H2,1-2H3;/q;-1/p+1.
What are the key properties of 1-butyl-3-methyl-2H-imidazole;hydron;hexafluorophosphate?
1-butyl-3-methyl-2H-imidazole;hydron;hexafluorophosphate has a molecular weight of 286.20 g/mol, XLogP of 4.96, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-3-methyl-2H-imidazole;hydron;hexafluorophosphate is sourced from PubChem (CID 174451662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).