About 1-butyl-3-methyl-2H-imidazole;phosphane;hexahydrofluoride
1-butyl-3-methyl-2H-imidazole;phosphane;hexahydrofluoride (PubChem CID 173166047) has the molecular formula C8H25F6N2P
and a molecular weight of 294.26 g/mol. Its IUPAC name is 1-butyl-3-methyl-2H-imidazole;phosphane;hexahydrofluoride.
Molecular Properties
| Compound Name | 1-butyl-3-methyl-2H-imidazole;phosphane;hexahydrofluoride |
| PubChem CID | 173166047 |
| Molecular Formula | C8H25F6N2P |
| Molecular Weight | 294.26 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | 1-butyl-3-methyl-2H-imidazole;phosphane;hexahydrofluoride |
| SMILES | CCCCN1C=CN(C)C1.F.F.F.F.F.F.P |
| InChI | InChI=1S/C8H16N2.6FH.H3P/c1-3-4-5-10-7-6-9(2)8-10;;;;;;;/h6-7H,3-5,8H2,1-2H3;6*1H;1H3 |
| InChIKey | AQDRYGWFGBSYES-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.26 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-butyl-3-methyl-2H-imidazole;phosphane;hexahydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-3-methyl-2H-imidazole;phosphane;hexahydrofluoride?
The IUPAC name of 1-butyl-3-methyl-2H-imidazole;phosphane;hexahydrofluoride (CID 173166047) is 1-butyl-3-methyl-2H-imidazole;phosphane;hexahydrofluoride.
What is the SMILES notation for 1-butyl-3-methyl-2H-imidazole;phosphane;hexahydrofluoride?
The canonical SMILES for 1-butyl-3-methyl-2H-imidazole;phosphane;hexahydrofluoride is CCCCN1C=CN(C)C1.F.F.F.F.F.F.P.
What is the InChIKey of 1-butyl-3-methyl-2H-imidazole;phosphane;hexahydrofluoride?
The InChIKey is AQDRYGWFGBSYES-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2.6FH.H3P/c1-3-4-5-10-7-6-9(2)8-10;;;;;;;/h6-7H,3-5,8H2,1-2H3;6*1H;1H3.
What are the key properties of 1-butyl-3-methyl-2H-imidazole;phosphane;hexahydrofluoride?
1-butyl-3-methyl-2H-imidazole;phosphane;hexahydrofluoride has a molecular weight of 294.26 g/mol, XLogP of 2.44, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-3-methyl-2H-imidazole;phosphane;hexahydrofluoride is sourced from PubChem (CID 173166047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).