About 1-decyl-3-methyl-2H-imidazole;hydrofluoride
1-decyl-3-methyl-2H-imidazole;hydrofluoride (PubChem CID 174870192) has the molecular formula C14H29FN2
and a molecular weight of 244.40 g/mol. Its IUPAC name is 1-decyl-3-methyl-2H-imidazole;hydrofluoride.
Molecular Properties
| Compound Name | 1-decyl-3-methyl-2H-imidazole;hydrofluoride |
| PubChem CID | 174870192 |
| Molecular Formula | C14H29FN2 |
| Molecular Weight | 244.40 g/mol |
| Exact Mass | 244.23 |
| IUPAC Name | 1-decyl-3-methyl-2H-imidazole;hydrofluoride |
| SMILES | CCCCCCCCCCN1C=CN(C)C1.F |
| InChI | InChI=1S/C14H28N2.FH/c1-3-4-5-6-7-8-9-10-11-16-13-12-15(2)14-16;/h12-13H,3-11,14H2,1-2H3;1H |
| InChIKey | DLJFMZWPUMNOON-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.40 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-decyl-3-methyl-2H-imidazole;hydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-decyl-3-methyl-2H-imidazole;hydrofluoride?
The IUPAC name of 1-decyl-3-methyl-2H-imidazole;hydrofluoride (CID 174870192) is 1-decyl-3-methyl-2H-imidazole;hydrofluoride.
What is the SMILES notation for 1-decyl-3-methyl-2H-imidazole;hydrofluoride?
The canonical SMILES for 1-decyl-3-methyl-2H-imidazole;hydrofluoride is CCCCCCCCCCN1C=CN(C)C1.F.
What is the InChIKey of 1-decyl-3-methyl-2H-imidazole;hydrofluoride?
The InChIKey is DLJFMZWPUMNOON-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28N2.FH/c1-3-4-5-6-7-8-9-10-11-16-13-12-15(2)14-16;/h12-13H,3-11,14H2,1-2H3;1H.
What are the key properties of 1-decyl-3-methyl-2H-imidazole;hydrofluoride?
1-decyl-3-methyl-2H-imidazole;hydrofluoride has a molecular weight of 244.40 g/mol, XLogP of 3.96, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-decyl-3-methyl-2H-imidazole;hydrofluoride is sourced from PubChem (CID 174870192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).