About dichlorozinc;1-hexyl-3-methyl-2H-imidazole
dichlorozinc;1-hexyl-3-methyl-2H-imidazole (PubChem CID 174760028) has the molecular formula C10H20Cl2N2Zn
and a molecular weight of 304.58 g/mol. Its IUPAC name is dichlorozinc;1-hexyl-3-methyl-2H-imidazole.
Molecular Properties
| Compound Name | dichlorozinc;1-hexyl-3-methyl-2H-imidazole |
| PubChem CID | 174760028 |
| Molecular Formula | C10H20Cl2N2Zn |
| Molecular Weight | 304.58 g/mol |
| Exact Mass | 302.03 |
| IUPAC Name | dichlorozinc;1-hexyl-3-methyl-2H-imidazole |
| SMILES | CCCCCCN1C=CN(C)C1.Cl[Zn]Cl |
| InChI | InChI=1S/C10H20N2.2ClH.Zn/c1-3-4-5-6-7-12-9-8-11(2)10-12;;;/h8-9H,3-7,10H2,1-2H3;2*1H;/q;;;+2/p-2 |
| InChIKey | ZQNZVBIROOWMGC-UHFFFAOYSA-L |
| XLogP | 3.62 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.58 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dichlorozinc;1-hexyl-3-methyl-2H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichlorozinc;1-hexyl-3-methyl-2H-imidazole?
The IUPAC name of dichlorozinc;1-hexyl-3-methyl-2H-imidazole (CID 174760028) is dichlorozinc;1-hexyl-3-methyl-2H-imidazole.
What is the SMILES notation for dichlorozinc;1-hexyl-3-methyl-2H-imidazole?
The canonical SMILES for dichlorozinc;1-hexyl-3-methyl-2H-imidazole is CCCCCCN1C=CN(C)C1.Cl[Zn]Cl.
What is the InChIKey of dichlorozinc;1-hexyl-3-methyl-2H-imidazole?
The InChIKey is ZQNZVBIROOWMGC-UHFFFAOYSA-L. The full InChI is InChI=1S/C10H20N2.2ClH.Zn/c1-3-4-5-6-7-12-9-8-11(2)10-12;;;/h8-9H,3-7,10H2,1-2H3;2*1H;/q;;;+2/p-2.
What are the key properties of dichlorozinc;1-hexyl-3-methyl-2H-imidazole?
dichlorozinc;1-hexyl-3-methyl-2H-imidazole has a molecular weight of 304.58 g/mol, XLogP of 3.62, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dichlorozinc;1-hexyl-3-methyl-2H-imidazole is sourced from PubChem (CID 174760028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).