About 1-methyl-3-undecyl-2H-imidazole;tetrachlorotitanium
1-methyl-3-undecyl-2H-imidazole;tetrachlorotitanium (PubChem CID 162018722) has the molecular formula C15H30Cl4N2Ti
and a molecular weight of 428.10 g/mol. Its IUPAC name is 1-methyl-3-undecyl-2H-imidazole;tetrachlorotitanium.
Molecular Properties
| Compound Name | 1-methyl-3-undecyl-2H-imidazole;tetrachlorotitanium |
| PubChem CID | 162018722 |
| Molecular Formula | C15H30Cl4N2Ti |
| Molecular Weight | 428.10 g/mol |
| Exact Mass | 426.06 |
| IUPAC Name | 1-methyl-3-undecyl-2H-imidazole;tetrachlorotitanium |
| SMILES | CCCCCCCCCCCN1C=CN(C)C1.Cl[Ti](Cl)(Cl)Cl |
| InChI | InChI=1S/C15H30N2.4ClH.Ti/c1-3-4-5-6-7-8-9-10-11-12-17-14-13-16(2)15-17;;;;;/h13-14H,3-12,15H2,1-2H3;4*1H;/q;;;;;+4/p-4 |
| InChIKey | YULTYZWDINDNJD-UHFFFAOYSA-J |
| XLogP | 6.95 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 428.10 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-3-undecyl-2H-imidazole;tetrachlorotitanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3-undecyl-2H-imidazole;tetrachlorotitanium?
The IUPAC name of 1-methyl-3-undecyl-2H-imidazole;tetrachlorotitanium (CID 162018722) is 1-methyl-3-undecyl-2H-imidazole;tetrachlorotitanium.
What is the SMILES notation for 1-methyl-3-undecyl-2H-imidazole;tetrachlorotitanium?
The canonical SMILES for 1-methyl-3-undecyl-2H-imidazole;tetrachlorotitanium is CCCCCCCCCCCN1C=CN(C)C1.Cl[Ti](Cl)(Cl)Cl.
What is the InChIKey of 1-methyl-3-undecyl-2H-imidazole;tetrachlorotitanium?
The InChIKey is YULTYZWDINDNJD-UHFFFAOYSA-J. The full InChI is InChI=1S/C15H30N2.4ClH.Ti/c1-3-4-5-6-7-8-9-10-11-12-17-14-13-16(2)15-17;;;;;/h13-14H,3-12,15H2,1-2H3;4*1H;/q;;;;;+4/p-4.
What are the key properties of 1-methyl-3-undecyl-2H-imidazole;tetrachlorotitanium?
1-methyl-3-undecyl-2H-imidazole;tetrachlorotitanium has a molecular weight of 428.10 g/mol, XLogP of 6.95, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3-undecyl-2H-imidazole;tetrachlorotitanium is sourced from PubChem (CID 162018722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).