About 1-butyl-3-methyl-2H-imidazole;molybdenum
1-butyl-3-methyl-2H-imidazole;molybdenum (PubChem CID 174105929) has the molecular formula C8H16MoN2
and a molecular weight of 236.17 g/mol. Its IUPAC name is 1-butyl-3-methyl-2H-imidazole;molybdenum.
Molecular Properties
| Compound Name | 1-butyl-3-methyl-2H-imidazole;molybdenum |
| PubChem CID | 174105929 |
| Molecular Formula | C8H16MoN2 |
| Molecular Weight | 236.17 g/mol |
| Exact Mass | 238.04 |
| IUPAC Name | 1-butyl-3-methyl-2H-imidazole;molybdenum |
| SMILES | CCCCN1C=CN(C)C1.[Mo] |
| InChI | InChI=1S/C8H16N2.Mo/c1-3-4-5-10-7-6-9(2)8-10;/h6-7H,3-5,8H2,1-2H3; |
| InChIKey | FXKHNHAXNGHWID-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.17 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-butyl-3-methyl-2H-imidazole;molybdenum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-3-methyl-2H-imidazole;molybdenum?
The IUPAC name of 1-butyl-3-methyl-2H-imidazole;molybdenum (CID 174105929) is 1-butyl-3-methyl-2H-imidazole;molybdenum.
What is the SMILES notation for 1-butyl-3-methyl-2H-imidazole;molybdenum?
The canonical SMILES for 1-butyl-3-methyl-2H-imidazole;molybdenum is CCCCN1C=CN(C)C1.[Mo].
What is the InChIKey of 1-butyl-3-methyl-2H-imidazole;molybdenum?
The InChIKey is FXKHNHAXNGHWID-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2.Mo/c1-3-4-5-10-7-6-9(2)8-10;/h6-7H,3-5,8H2,1-2H3;.
What are the key properties of 1-butyl-3-methyl-2H-imidazole;molybdenum?
1-butyl-3-methyl-2H-imidazole;molybdenum has a molecular weight of 236.17 g/mol, XLogP of 1.46, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-3-methyl-2H-imidazole;molybdenum is sourced from PubChem (CID 174105929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).