About zinc;1-butyl-3-methyl-2H-imidazole;ditetrafluoroborate
zinc;1-butyl-3-methyl-2H-imidazole;ditetrafluoroborate (PubChem CID 175542670) has the molecular formula C8H16B2F8N2Zn
and a molecular weight of 379.23 g/mol. Its IUPAC name is zinc;1-butyl-3-methyl-2H-imidazole;ditetrafluoroborate.
Molecular Properties
| Compound Name | zinc;1-butyl-3-methyl-2H-imidazole;ditetrafluoroborate |
| PubChem CID | 175542670 |
| Molecular Formula | C8H16B2F8N2Zn |
| Molecular Weight | 379.23 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | zinc;1-butyl-3-methyl-2H-imidazole;ditetrafluoroborate |
| SMILES | CCCCN1C=CN(C)C1.F[B-](F)(F)F.F[B-](F)(F)F.[Zn+2] |
| InChI | InChI=1S/C8H16N2.2BF4.Zn/c1-3-4-5-10-7-6-9(2)8-10;2*2-1(3,4)5;/h6-7H,3-5,8H2,1-2H3;;;/q;2*-1;+2 |
| InChIKey | ZFKILCAUOOIGNV-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.23 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze zinc;1-butyl-3-methyl-2H-imidazole;ditetrafluoroborate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc;1-butyl-3-methyl-2H-imidazole;ditetrafluoroborate?
The IUPAC name of zinc;1-butyl-3-methyl-2H-imidazole;ditetrafluoroborate (CID 175542670) is zinc;1-butyl-3-methyl-2H-imidazole;ditetrafluoroborate.
What is the SMILES notation for zinc;1-butyl-3-methyl-2H-imidazole;ditetrafluoroborate?
The canonical SMILES for zinc;1-butyl-3-methyl-2H-imidazole;ditetrafluoroborate is CCCCN1C=CN(C)C1.F[B-](F)(F)F.F[B-](F)(F)F.[Zn+2].
What is the InChIKey of zinc;1-butyl-3-methyl-2H-imidazole;ditetrafluoroborate?
The InChIKey is ZFKILCAUOOIGNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2.2BF4.Zn/c1-3-4-5-10-7-6-9(2)8-10;2*2-1(3,4)5;/h6-7H,3-5,8H2,1-2H3;;;/q;2*-1;+2.
What are the key properties of zinc;1-butyl-3-methyl-2H-imidazole;ditetrafluoroborate?
zinc;1-butyl-3-methyl-2H-imidazole;ditetrafluoroborate has a molecular weight of 379.23 g/mol, XLogP of 4.06, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for zinc;1-butyl-3-methyl-2H-imidazole;ditetrafluoroborate is sourced from PubChem (CID 175542670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).