C8H19BF4N2O4P- — CID 175710160
1-butyl-3-methyl-2H-imidazole;phosphoric acid;tetrafluoroborate (PubChem CID 175710160) has the molecular formula C8H19BF4N2O4P- and a molecular weight of 325.03 g/mol. Its IUPAC name is 1-butyl-3-methyl-2H-imidazole;phosphoric acid;tetrafluoroborate.
| Compound Name | 1-butyl-3-methyl-2H-imidazole;phosphoric acid;tetrafluoroborate |
|---|---|
| PubChem CID | 175710160 |
| Molecular Formula | C8H19BF4N2O4P- |
| Molecular Weight | 325.03 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | 1-butyl-3-methyl-2H-imidazole;phosphoric acid;tetrafluoroborate |
| SMILES | CCCCN1C=CN(C)C1.F[B-](F)(F)F.O=P(O)(O)O |
| InChI | InChI=1S/C8H16N2.BF4.H3O4P/c1-3-4-5-10-7-6-9(2)8-10;2-1(3,4)5;1-5(2,3)4/h6-7H,3-5,8H2,1-2H3;;(H3,1,2,3,4)/q;-1; |
| InChIKey | QZJBBXXYFQTGSS-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.03 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|