About 1-butyl-3-methyl-2H-imidazole;tetrakis(carbonofluoridic acid)
1-butyl-3-methyl-2H-imidazole;tetrakis(carbonofluoridic acid) (PubChem CID 175410531) has the molecular formula C12H20F4N2O8
and a molecular weight of 396.29 g/mol. Its IUPAC name is 1-butyl-3-methyl-2H-imidazole;tetrakis(carbonofluoridic acid).
Molecular Properties
| Compound Name | 1-butyl-3-methyl-2H-imidazole;tetrakis(carbonofluoridic acid) |
| PubChem CID | 175410531 |
| Molecular Formula | C12H20F4N2O8 |
| Molecular Weight | 396.29 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | 1-butyl-3-methyl-2H-imidazole;tetrakis(carbonofluoridic acid) |
| SMILES | CCCCN1C=CN(C)C1.O=C(O)F.O=C(O)F.O=C(O)F.O=C(O)F |
| InChI | InChI=1S/C8H16N2.4CHFO2/c1-3-4-5-10-7-6-9(2)8-10;4*2-1(3)4/h6-7H,3-5,8H2,1-2H3;4*(H,3,4) |
| InChIKey | GSWWDMSHOHVLIY-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 155.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.29 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-butyl-3-methyl-2H-imidazole;tetrakis(carbonofluoridic acid) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-3-methyl-2H-imidazole;tetrakis(carbonofluoridic acid)?
The IUPAC name of 1-butyl-3-methyl-2H-imidazole;tetrakis(carbonofluoridic acid) (CID 175410531) is 1-butyl-3-methyl-2H-imidazole;tetrakis(carbonofluoridic acid).
What is the SMILES notation for 1-butyl-3-methyl-2H-imidazole;tetrakis(carbonofluoridic acid)?
The canonical SMILES for 1-butyl-3-methyl-2H-imidazole;tetrakis(carbonofluoridic acid) is CCCCN1C=CN(C)C1.O=C(O)F.O=C(O)F.O=C(O)F.O=C(O)F.
What is the InChIKey of 1-butyl-3-methyl-2H-imidazole;tetrakis(carbonofluoridic acid)?
The InChIKey is GSWWDMSHOHVLIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2.4CHFO2/c1-3-4-5-10-7-6-9(2)8-10;4*2-1(3)4/h6-7H,3-5,8H2,1-2H3;4*(H,3,4).
What are the key properties of 1-butyl-3-methyl-2H-imidazole;tetrakis(carbonofluoridic acid)?
1-butyl-3-methyl-2H-imidazole;tetrakis(carbonofluoridic acid) has a molecular weight of 396.29 g/mol, XLogP of 4.00, 3 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-3-methyl-2H-imidazole;tetrakis(carbonofluoridic acid) is sourced from PubChem (CID 175410531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).