About CID 175550645
CID 175550645 (PubChem CID 175550645) has the molecular formula C8H16F3N2OP
and a molecular weight of 244.20 g/mol.
Molecular Properties
| Compound Name | CID 175550645 |
| PubChem CID | 175550645 |
| Molecular Formula | C8H16F3N2OP |
| Molecular Weight | 244.20 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | — |
| SMILES | CCCCN1C=CN(C)C1.O=P(F)(F)F |
| InChI | InChI=1S/C8H16N2.F3OP/c1-3-4-5-10-7-6-9(2)8-10;1-5(2,3)4/h6-7H,3-5,8H2,1-2H3; |
| InChIKey | MBNFOGMJSOCVEH-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.20 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 175550645 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 175550645?
The IUPAC name of CID 175550645 (CID 175550645) is not available.
What is the SMILES notation for CID 175550645?
The canonical SMILES for CID 175550645 is CCCCN1C=CN(C)C1.O=P(F)(F)F.
What is the InChIKey of CID 175550645?
The InChIKey is MBNFOGMJSOCVEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2.F3OP/c1-3-4-5-10-7-6-9(2)8-10;1-5(2,3)4/h6-7H,3-5,8H2,1-2H3;.
What are the key properties of CID 175550645?
CID 175550645 has a molecular weight of 244.20 g/mol, XLogP of 3.47, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 175550645 is sourced from PubChem (CID 175550645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).