About trisodium;1-butyl-3-methyl-2H-imidazole;phosphate
trisodium;1-butyl-3-methyl-2H-imidazole;phosphate (PubChem CID 174105917) has the molecular formula C8H16N2Na3O4P
and a molecular weight of 304.17 g/mol. Its IUPAC name is trisodium;1-butyl-3-methyl-2H-imidazole;phosphate.
Molecular Properties
| Compound Name | trisodium;1-butyl-3-methyl-2H-imidazole;phosphate |
| PubChem CID | 174105917 |
| Molecular Formula | C8H16N2Na3O4P |
| Molecular Weight | 304.17 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | trisodium;1-butyl-3-methyl-2H-imidazole;phosphate |
| SMILES | CCCCN1C=CN(C)C1.O=P([O-])([O-])[O-].[Na+].[Na+].[Na+] |
| InChI | InChI=1S/C8H16N2.3Na.H3O4P/c1-3-4-5-10-7-6-9(2)8-10;;;;1-5(2,3)4/h6-7H,3-5,8H2,1-2H3;;;;(H3,1,2,3,4)/q;3*+1;/p-3 |
| InChIKey | VAITZRTXGJAKAH-UHFFFAOYSA-K |
| XLogP | -10.35 |
| TPSA | 92.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.17 |
| LogP ≤ 5 | -10.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze trisodium;1-butyl-3-methyl-2H-imidazole;phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trisodium;1-butyl-3-methyl-2H-imidazole;phosphate?
The IUPAC name of trisodium;1-butyl-3-methyl-2H-imidazole;phosphate (CID 174105917) is trisodium;1-butyl-3-methyl-2H-imidazole;phosphate.
What is the SMILES notation for trisodium;1-butyl-3-methyl-2H-imidazole;phosphate?
The canonical SMILES for trisodium;1-butyl-3-methyl-2H-imidazole;phosphate is CCCCN1C=CN(C)C1.O=P([O-])([O-])[O-].[Na+].[Na+].[Na+].
What is the InChIKey of trisodium;1-butyl-3-methyl-2H-imidazole;phosphate?
The InChIKey is VAITZRTXGJAKAH-UHFFFAOYSA-K. The full InChI is InChI=1S/C8H16N2.3Na.H3O4P/c1-3-4-5-10-7-6-9(2)8-10;;;;1-5(2,3)4/h6-7H,3-5,8H2,1-2H3;;;;(H3,1,2,3,4)/q;3*+1;/p-3.
What are the key properties of trisodium;1-butyl-3-methyl-2H-imidazole;phosphate?
trisodium;1-butyl-3-methyl-2H-imidazole;phosphate has a molecular weight of 304.17 g/mol, XLogP of -10.35, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for trisodium;1-butyl-3-methyl-2H-imidazole;phosphate is sourced from PubChem (CID 174105917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).