About aluminum;1-butyl-3-methyl-2H-imidazole;trichloride;hydrochloride
aluminum;1-butyl-3-methyl-2H-imidazole;trichloride;hydrochloride (PubChem CID 172848443) has the molecular formula C8H17AlCl4N2
and a molecular weight of 310.03 g/mol. Its IUPAC name is aluminum;1-butyl-3-methyl-2H-imidazole;trichloride;hydrochloride.
Molecular Properties
| Compound Name | aluminum;1-butyl-3-methyl-2H-imidazole;trichloride;hydrochloride |
| PubChem CID | 172848443 |
| Molecular Formula | C8H17AlCl4N2 |
| Molecular Weight | 310.03 g/mol |
| Exact Mass | 308.00 |
| IUPAC Name | aluminum;1-butyl-3-methyl-2H-imidazole;trichloride;hydrochloride |
| SMILES | CCCCN1C=CN(C)C1.Cl.[Al+3].[Cl-].[Cl-].[Cl-] |
| InChI | InChI=1S/C8H16N2.Al.4ClH/c1-3-4-5-10-7-6-9(2)8-10;;;;;/h6-7H,3-5,8H2,1-2H3;;4*1H/q;+3;;;;/p-3 |
| InChIKey | XSYMGZDMMSYEMQ-UHFFFAOYSA-K |
| XLogP | -7.48 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.03 |
| LogP ≤ 5 | -7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze aluminum;1-butyl-3-methyl-2H-imidazole;trichloride;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aluminum;1-butyl-3-methyl-2H-imidazole;trichloride;hydrochloride?
The IUPAC name of aluminum;1-butyl-3-methyl-2H-imidazole;trichloride;hydrochloride (CID 172848443) is aluminum;1-butyl-3-methyl-2H-imidazole;trichloride;hydrochloride.
What is the SMILES notation for aluminum;1-butyl-3-methyl-2H-imidazole;trichloride;hydrochloride?
The canonical SMILES for aluminum;1-butyl-3-methyl-2H-imidazole;trichloride;hydrochloride is CCCCN1C=CN(C)C1.Cl.[Al+3].[Cl-].[Cl-].[Cl-].
What is the InChIKey of aluminum;1-butyl-3-methyl-2H-imidazole;trichloride;hydrochloride?
The InChIKey is XSYMGZDMMSYEMQ-UHFFFAOYSA-K. The full InChI is InChI=1S/C8H16N2.Al.4ClH/c1-3-4-5-10-7-6-9(2)8-10;;;;;/h6-7H,3-5,8H2,1-2H3;;4*1H/q;+3;;;;/p-3.
What are the key properties of aluminum;1-butyl-3-methyl-2H-imidazole;trichloride;hydrochloride?
aluminum;1-butyl-3-methyl-2H-imidazole;trichloride;hydrochloride has a molecular weight of 310.03 g/mol, XLogP of -7.48, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for aluminum;1-butyl-3-methyl-2H-imidazole;trichloride;hydrochloride is sourced from PubChem (CID 172848443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).