About 1-butyl-3-methyl-2H-imidazole;lanthanum(3+);trinitrate
1-butyl-3-methyl-2H-imidazole;lanthanum(3+);trinitrate (PubChem CID 174692909) has the molecular formula C8H16LaN5O9
and a molecular weight of 465.15 g/mol. Its IUPAC name is 1-butyl-3-methyl-2H-imidazole;lanthanum(3+);trinitrate.
Molecular Properties
| Compound Name | 1-butyl-3-methyl-2H-imidazole;lanthanum(3+);trinitrate |
| PubChem CID | 174692909 |
| Molecular Formula | C8H16LaN5O9 |
| Molecular Weight | 465.15 g/mol |
| Exact Mass | 465.00 |
| IUPAC Name | 1-butyl-3-methyl-2H-imidazole;lanthanum(3+);trinitrate |
| SMILES | CCCCN1C=CN(C)C1.O=[N+]([O-])[O-].O=[N+]([O-])[O-].O=[N+]([O-])[O-].[La+3] |
| InChI | InChI=1S/C8H16N2.La.3NO3/c1-3-4-5-10-7-6-9(2)8-10;;3*2-1(3)4/h6-7H,3-5,8H2,1-2H3;;;;/q;+3;3*-1 |
| InChIKey | BHRFUFGZLSZFKT-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 205.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 465.15 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-butyl-3-methyl-2H-imidazole;lanthanum(3+);trinitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-3-methyl-2H-imidazole;lanthanum(3+);trinitrate?
The IUPAC name of 1-butyl-3-methyl-2H-imidazole;lanthanum(3+);trinitrate (CID 174692909) is 1-butyl-3-methyl-2H-imidazole;lanthanum(3+);trinitrate.
What is the SMILES notation for 1-butyl-3-methyl-2H-imidazole;lanthanum(3+);trinitrate?
The canonical SMILES for 1-butyl-3-methyl-2H-imidazole;lanthanum(3+);trinitrate is CCCCN1C=CN(C)C1.O=[N+]([O-])[O-].O=[N+]([O-])[O-].O=[N+]([O-])[O-].[La+3].
What is the InChIKey of 1-butyl-3-methyl-2H-imidazole;lanthanum(3+);trinitrate?
The InChIKey is BHRFUFGZLSZFKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2.La.3NO3/c1-3-4-5-10-7-6-9(2)8-10;;3*2-1(3)4/h6-7H,3-5,8H2,1-2H3;;;;/q;+3;3*-1.
What are the key properties of 1-butyl-3-methyl-2H-imidazole;lanthanum(3+);trinitrate?
1-butyl-3-methyl-2H-imidazole;lanthanum(3+);trinitrate has a molecular weight of 465.15 g/mol, XLogP of 0.75, 3 rotatable bonds, 0 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-3-methyl-2H-imidazole;lanthanum(3+);trinitrate is sourced from PubChem (CID 174692909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).