About 1-hexyl-3-methyl-2H-imidazole;nitric acid
1-hexyl-3-methyl-2H-imidazole;nitric acid (PubChem CID 170919718) has the molecular formula C10H21N3O3
and a molecular weight of 231.30 g/mol. Its IUPAC name is 1-hexyl-3-methyl-2H-imidazole;nitric acid.
Molecular Properties
| Compound Name | 1-hexyl-3-methyl-2H-imidazole;nitric acid |
| PubChem CID | 170919718 |
| Molecular Formula | C10H21N3O3 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | 1-hexyl-3-methyl-2H-imidazole;nitric acid |
| SMILES | CCCCCCN1C=CN(C)C1.O=[N+]([O-])O |
| InChI | InChI=1S/C10H20N2.HNO3/c1-3-4-5-6-7-12-9-8-11(2)10-12;2-1(3)4/h8-9H,3-7,10H2,1-2H3;(H,2,3,4) |
| InChIKey | NAOWDMXORJEQFW-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 69.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-hexyl-3-methyl-2H-imidazole;nitric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hexyl-3-methyl-2H-imidazole;nitric acid?
The IUPAC name of 1-hexyl-3-methyl-2H-imidazole;nitric acid (CID 170919718) is 1-hexyl-3-methyl-2H-imidazole;nitric acid.
What is the SMILES notation for 1-hexyl-3-methyl-2H-imidazole;nitric acid?
The canonical SMILES for 1-hexyl-3-methyl-2H-imidazole;nitric acid is CCCCCCN1C=CN(C)C1.O=[N+]([O-])O.
What is the InChIKey of 1-hexyl-3-methyl-2H-imidazole;nitric acid?
The InChIKey is NAOWDMXORJEQFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2.HNO3/c1-3-4-5-6-7-12-9-8-11(2)10-12;2-1(3)4/h8-9H,3-7,10H2,1-2H3;(H,2,3,4).
What are the key properties of 1-hexyl-3-methyl-2H-imidazole;nitric acid?
1-hexyl-3-methyl-2H-imidazole;nitric acid has a molecular weight of 231.30 g/mol, XLogP of 1.90, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hexyl-3-methyl-2H-imidazole;nitric acid is sourced from PubChem (CID 170919718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).