About 1-decyl-3-methyl-2H-imidazole;fluoro dihydrogen phosphate
1-decyl-3-methyl-2H-imidazole;fluoro dihydrogen phosphate (PubChem CID 174488008) has the molecular formula C14H30FN2O4P
and a molecular weight of 340.38 g/mol. Its IUPAC name is 1-decyl-3-methyl-2H-imidazole;fluoro dihydrogen phosphate.
Molecular Properties
| Compound Name | 1-decyl-3-methyl-2H-imidazole;fluoro dihydrogen phosphate |
| PubChem CID | 174488008 |
| Molecular Formula | C14H30FN2O4P |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | 1-decyl-3-methyl-2H-imidazole;fluoro dihydrogen phosphate |
| SMILES | CCCCCCCCCCN1C=CN(C)C1.O=P(O)(O)OF |
| InChI | InChI=1S/C14H28N2.FH2O4P/c1-3-4-5-6-7-8-9-10-11-16-13-12-15(2)14-16;1-5-6(2,3)4/h12-13H,3-11,14H2,1-2H3;(H2,2,3,4) |
| InChIKey | WMGYULGEYXMLJC-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 73.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-decyl-3-methyl-2H-imidazole;fluoro dihydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-decyl-3-methyl-2H-imidazole;fluoro dihydrogen phosphate?
The IUPAC name of 1-decyl-3-methyl-2H-imidazole;fluoro dihydrogen phosphate (CID 174488008) is 1-decyl-3-methyl-2H-imidazole;fluoro dihydrogen phosphate.
What is the SMILES notation for 1-decyl-3-methyl-2H-imidazole;fluoro dihydrogen phosphate?
The canonical SMILES for 1-decyl-3-methyl-2H-imidazole;fluoro dihydrogen phosphate is CCCCCCCCCCN1C=CN(C)C1.O=P(O)(O)OF.
What is the InChIKey of 1-decyl-3-methyl-2H-imidazole;fluoro dihydrogen phosphate?
The InChIKey is WMGYULGEYXMLJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28N2.FH2O4P/c1-3-4-5-6-7-8-9-10-11-16-13-12-15(2)14-16;1-5-6(2,3)4/h12-13H,3-11,14H2,1-2H3;(H2,2,3,4).
What are the key properties of 1-decyl-3-methyl-2H-imidazole;fluoro dihydrogen phosphate?
1-decyl-3-methyl-2H-imidazole;fluoro dihydrogen phosphate has a molecular weight of 340.38 g/mol, XLogP of 3.78, 10 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-decyl-3-methyl-2H-imidazole;fluoro dihydrogen phosphate is sourced from PubChem (CID 174488008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).