C15H32N2O4S — CID 174732744
methyl hydrogen sulfate;1-methyl-3-(2-propylheptyl)-2H-imidazole (PubChem CID 174732744) has the molecular formula C15H32N2O4S and a molecular weight of 336.50 g/mol. Its IUPAC name is methyl hydrogen sulfate;1-methyl-3-(2-propylheptyl)-2H-imidazole.
| Compound Name | methyl hydrogen sulfate;1-methyl-3-(2-propylheptyl)-2H-imidazole |
|---|---|
| PubChem CID | 174732744 |
| Molecular Formula | C15H32N2O4S |
| Molecular Weight | 336.50 g/mol |
| Exact Mass | 336.21 |
| IUPAC Name | methyl hydrogen sulfate;1-methyl-3-(2-propylheptyl)-2H-imidazole |
| SMILES | CCCCCC(CCC)CN1C=CN(C)C1.COS(=O)(=O)O |
| InChI | InChI=1S/C14H28N2.CH4O4S/c1-4-6-7-9-14(8-5-2)12-16-11-10-15(3)13-16;1-5-6(2,3)4/h10-11,14H,4-9,12-13H2,1-3H3;1H3,(H,2,3,4) |
| InChIKey | IDHFUIDVLNAAPB-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.50 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|