C9H19N3O5S — CID 173032673
N-ethyl-N,3-dimethyl-2H-imidazole-1-carboxamide;methyl hydrogen sulfate (PubChem CID 173032673) has the molecular formula C9H19N3O5S and a molecular weight of 281.33 g/mol. Its IUPAC name is N-ethyl-N,3-dimethyl-2H-imidazole-1-carboxamide;methyl hydrogen sulfate.
| Compound Name | N-ethyl-N,3-dimethyl-2H-imidazole-1-carboxamide;methyl hydrogen sulfate |
|---|---|
| PubChem CID | 173032673 |
| Molecular Formula | C9H19N3O5S |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | N-ethyl-N,3-dimethyl-2H-imidazole-1-carboxamide;methyl hydrogen sulfate |
| SMILES | CCN(C)C(=O)N1C=CN(C)C1.COS(=O)(=O)O |
| InChI | InChI=1S/C8H15N3O.CH4O4S/c1-4-10(3)8(12)11-6-5-9(2)7-11;1-5-6(2,3)4/h5-6H,4,7H2,1-3H3;1H3,(H,2,3,4) |
| InChIKey | DRSAEUAMUHNHMD-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|