About carboxy carboxyoxycarbonyl carbonate;1-methyl-3-octyl-2H-imidazole
carboxy carboxyoxycarbonyl carbonate;1-methyl-3-octyl-2H-imidazole (PubChem CID 175465520) has the molecular formula C16H26N2O9
and a molecular weight of 390.39 g/mol. Its IUPAC name is carboxy carboxyoxycarbonyl carbonate;1-methyl-3-octyl-2H-imidazole.
Molecular Properties
| Compound Name | carboxy carboxyoxycarbonyl carbonate;1-methyl-3-octyl-2H-imidazole |
| PubChem CID | 175465520 |
| Molecular Formula | C16H26N2O9 |
| Molecular Weight | 390.39 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | carboxy carboxyoxycarbonyl carbonate;1-methyl-3-octyl-2H-imidazole |
| SMILES | CCCCCCCCN1C=CN(C)C1.O=C(O)OC(=O)OC(=O)OC(=O)O |
| InChI | InChI=1S/C12H24N2.C4H2O9/c1-3-4-5-6-7-8-9-14-11-10-13(2)12-14;5-1(6)11-3(9)13-4(10)12-2(7)8/h10-11H,3-9,12H2,1-2H3;(H,5,6)(H,7,8) |
| InChIKey | PBYRKXOHWRRDCE-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 142.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.39 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze carboxy carboxyoxycarbonyl carbonate;1-methyl-3-octyl-2H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carboxy carboxyoxycarbonyl carbonate;1-methyl-3-octyl-2H-imidazole?
The IUPAC name of carboxy carboxyoxycarbonyl carbonate;1-methyl-3-octyl-2H-imidazole (CID 175465520) is carboxy carboxyoxycarbonyl carbonate;1-methyl-3-octyl-2H-imidazole.
What is the SMILES notation for carboxy carboxyoxycarbonyl carbonate;1-methyl-3-octyl-2H-imidazole?
The canonical SMILES for carboxy carboxyoxycarbonyl carbonate;1-methyl-3-octyl-2H-imidazole is CCCCCCCCN1C=CN(C)C1.O=C(O)OC(=O)OC(=O)OC(=O)O.
What is the InChIKey of carboxy carboxyoxycarbonyl carbonate;1-methyl-3-octyl-2H-imidazole?
The InChIKey is PBYRKXOHWRRDCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2.C4H2O9/c1-3-4-5-6-7-8-9-14-11-10-13(2)12-14;5-1(6)11-3(9)13-4(10)12-2(7)8/h10-11H,3-9,12H2,1-2H3;(H,5,6)(H,7,8).
What are the key properties of carboxy carboxyoxycarbonyl carbonate;1-methyl-3-octyl-2H-imidazole?
carboxy carboxyoxycarbonyl carbonate;1-methyl-3-octyl-2H-imidazole has a molecular weight of 390.39 g/mol, XLogP of 3.66, 7 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for carboxy carboxyoxycarbonyl carbonate;1-methyl-3-octyl-2H-imidazole is sourced from PubChem (CID 175465520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).