About 1-ethenyl-3-heptyl-2H-imidazole;tetrafluoroborate;hydrochloride
1-ethenyl-3-heptyl-2H-imidazole;tetrafluoroborate;hydrochloride (PubChem CID 175189511) has the molecular formula C12H23BClF4N2-
and a molecular weight of 317.59 g/mol. Its IUPAC name is 1-ethenyl-3-heptyl-2H-imidazole;tetrafluoroborate;hydrochloride.
Molecular Properties
| Compound Name | 1-ethenyl-3-heptyl-2H-imidazole;tetrafluoroborate;hydrochloride |
| PubChem CID | 175189511 |
| Molecular Formula | C12H23BClF4N2- |
| Molecular Weight | 317.59 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | 1-ethenyl-3-heptyl-2H-imidazole;tetrafluoroborate;hydrochloride |
| SMILES | C=CN1C=CN(CCCCCCC)C1.Cl.F[B-](F)(F)F |
| InChI | InChI=1S/C12H22N2.BF4.ClH/c1-3-5-6-7-8-9-14-11-10-13(4-2)12-14;2-1(3,4)5;/h4,10-11H,2-3,5-9,12H2,1H3;;1H/q;-1; |
| InChIKey | WYXKQHUUINXKDD-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.59 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-ethenyl-3-heptyl-2H-imidazole;tetrafluoroborate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenyl-3-heptyl-2H-imidazole;tetrafluoroborate;hydrochloride?
The IUPAC name of 1-ethenyl-3-heptyl-2H-imidazole;tetrafluoroborate;hydrochloride (CID 175189511) is 1-ethenyl-3-heptyl-2H-imidazole;tetrafluoroborate;hydrochloride.
What is the SMILES notation for 1-ethenyl-3-heptyl-2H-imidazole;tetrafluoroborate;hydrochloride?
The canonical SMILES for 1-ethenyl-3-heptyl-2H-imidazole;tetrafluoroborate;hydrochloride is C=CN1C=CN(CCCCCCC)C1.Cl.F[B-](F)(F)F.
What is the InChIKey of 1-ethenyl-3-heptyl-2H-imidazole;tetrafluoroborate;hydrochloride?
The InChIKey is WYXKQHUUINXKDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2.BF4.ClH/c1-3-5-6-7-8-9-14-11-10-13(4-2)12-14;2-1(3,4)5;/h4,10-11H,2-3,5-9,12H2,1H3;;1H/q;-1;.
What are the key properties of 1-ethenyl-3-heptyl-2H-imidazole;tetrafluoroborate;hydrochloride?
1-ethenyl-3-heptyl-2H-imidazole;tetrafluoroborate;hydrochloride has a molecular weight of 317.59 g/mol, XLogP of 4.87, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenyl-3-heptyl-2H-imidazole;tetrafluoroborate;hydrochloride is sourced from PubChem (CID 175189511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).