About 1-decyl-3-ethenyl-2H-imidazole;prop-2-enoic acid;hydrobromide
1-decyl-3-ethenyl-2H-imidazole;prop-2-enoic acid;hydrobromide (PubChem CID 175052158) has the molecular formula C18H33BrN2O2
and a molecular weight of 389.38 g/mol. Its IUPAC name is 1-decyl-3-ethenyl-2H-imidazole;prop-2-enoic acid;hydrobromide.
Molecular Properties
| Compound Name | 1-decyl-3-ethenyl-2H-imidazole;prop-2-enoic acid;hydrobromide |
| PubChem CID | 175052158 |
| Molecular Formula | C18H33BrN2O2 |
| Molecular Weight | 389.38 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | 1-decyl-3-ethenyl-2H-imidazole;prop-2-enoic acid;hydrobromide |
| SMILES | Br.C=CC(=O)O.C=CN1C=CN(CCCCCCCCCC)C1 |
| InChI | InChI=1S/C15H28N2.C3H4O2.BrH/c1-3-5-6-7-8-9-10-11-12-17-14-13-16(4-2)15-17;1-2-3(4)5;/h4,13-14H,2-3,5-12,15H2,1H3;2H,1H2,(H,4,5);1H |
| InChIKey | XQQICOGIKFZPJA-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 389.38 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-decyl-3-ethenyl-2H-imidazole;prop-2-enoic acid;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-decyl-3-ethenyl-2H-imidazole;prop-2-enoic acid;hydrobromide?
The IUPAC name of 1-decyl-3-ethenyl-2H-imidazole;prop-2-enoic acid;hydrobromide (CID 175052158) is 1-decyl-3-ethenyl-2H-imidazole;prop-2-enoic acid;hydrobromide.
What is the SMILES notation for 1-decyl-3-ethenyl-2H-imidazole;prop-2-enoic acid;hydrobromide?
The canonical SMILES for 1-decyl-3-ethenyl-2H-imidazole;prop-2-enoic acid;hydrobromide is Br.C=CC(=O)O.C=CN1C=CN(CCCCCCCCCC)C1.
What is the InChIKey of 1-decyl-3-ethenyl-2H-imidazole;prop-2-enoic acid;hydrobromide?
The InChIKey is XQQICOGIKFZPJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28N2.C3H4O2.BrH/c1-3-5-6-7-8-9-10-11-12-17-14-13-16(4-2)15-17;1-2-3(4)5;/h4,13-14H,2-3,5-12,15H2,1H3;2H,1H2,(H,4,5);1H.
What are the key properties of 1-decyl-3-ethenyl-2H-imidazole;prop-2-enoic acid;hydrobromide?
1-decyl-3-ethenyl-2H-imidazole;prop-2-enoic acid;hydrobromide has a molecular weight of 389.38 g/mol, XLogP of 5.15, 11 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-decyl-3-ethenyl-2H-imidazole;prop-2-enoic acid;hydrobromide is sourced from PubChem (CID 175052158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).