C14H28BF4N2O3Si- — CID 174058071
3-(3-ethenyl-2H-imidazol-1-yl)propyl-triethoxysilane tetrafluoroborate (PubChem CID 174058071) has the molecular formula C14H28BF4N2O3Si- and a molecular weight of 387.28 g/mol. Its IUPAC name is 3-(3-ethenyl-2H-imidazol-1-yl)propyl-triethoxysilane tetrafluoroborate.
| Compound Name | 3-(3-ethenyl-2H-imidazol-1-yl)propyl-triethoxysilane tetrafluoroborate |
|---|---|
| PubChem CID | 174058071 |
| Molecular Formula | C14H28BF4N2O3Si- |
| Molecular Weight | 387.28 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | 3-(3-ethenyl-2H-imidazol-1-yl)propyl-triethoxysilane tetrafluoroborate |
| SMILES | C=CN1C=CN(CCC[Si](OCC)(OCC)OCC)C1.F[B-](F)(F)F |
| InChI | InChI=1S/C14H28N2O3Si.BF4/c1-5-15-11-12-16(14-15)10-9-13-20(17-6-2,18-7-3)19-8-4;2-1(3,4)5/h5,11-12H,1,6-10,13-14H2,2-4H3;/q;-1 |
| InChIKey | ZBWGUXBTNFMVEK-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.28 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|