C18H41N3O3Si — CID 153419971
3-(3,5-dipropyl-1,3,5-triazinan-1-yl)propyl-triethoxysilane (PubChem CID 153419971) has the molecular formula C18H41N3O3Si and a molecular weight of 375.63 g/mol. Its IUPAC name is 3-(3,5-dipropyl-1,3,5-triazinan-1-yl)propyl-triethoxysilane.
| Compound Name | 3-(3,5-dipropyl-1,3,5-triazinan-1-yl)propyl-triethoxysilane |
|---|---|
| PubChem CID | 153419971 |
| Molecular Formula | C18H41N3O3Si |
| Molecular Weight | 375.63 g/mol |
| Exact Mass | 375.29 |
| IUPAC Name | 3-(3,5-dipropyl-1,3,5-triazinan-1-yl)propyl-triethoxysilane |
| SMILES | CCCN1CN(CCC)CN(CCC[Si](OCC)(OCC)OCC)C1 |
| InChI | InChI=1S/C18H41N3O3Si/c1-6-12-19-16-20(13-7-2)18-21(17-19)14-11-15-25(22-8-3,23-9-4)24-10-5/h6-18H2,1-5H3 |
| InChIKey | JZVNDVJHKBCYBH-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 37.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.63 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|