About triethoxy(nonyl)silane;hydrofluoride
triethoxy(nonyl)silane;hydrofluoride (PubChem CID 161088856) has the molecular formula C15H35FO3Si
and a molecular weight of 310.53 g/mol. Its IUPAC name is triethoxy(nonyl)silane;hydrofluoride.
Molecular Properties
| Compound Name | triethoxy(nonyl)silane;hydrofluoride |
| PubChem CID | 161088856 |
| Molecular Formula | C15H35FO3Si |
| Molecular Weight | 310.53 g/mol |
| Exact Mass | 310.23 |
| IUPAC Name | triethoxy(nonyl)silane;hydrofluoride |
| SMILES | CCCCCCCCC[Si](OCC)(OCC)OCC.F |
| InChI | InChI=1S/C15H34O3Si.FH/c1-5-9-10-11-12-13-14-15-19(16-6-2,17-7-3)18-8-4;/h5-15H2,1-4H3;1H |
| InChIKey | AILBTEJETHRMPL-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.53 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze triethoxy(nonyl)silane;hydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethoxy(nonyl)silane;hydrofluoride?
The IUPAC name of triethoxy(nonyl)silane;hydrofluoride (CID 161088856) is triethoxy(nonyl)silane;hydrofluoride.
What is the SMILES notation for triethoxy(nonyl)silane;hydrofluoride?
The canonical SMILES for triethoxy(nonyl)silane;hydrofluoride is CCCCCCCCC[Si](OCC)(OCC)OCC.F.
What is the InChIKey of triethoxy(nonyl)silane;hydrofluoride?
The InChIKey is AILBTEJETHRMPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H34O3Si.FH/c1-5-9-10-11-12-13-14-15-19(16-6-2,17-7-3)18-8-4;/h5-15H2,1-4H3;1H.
What are the key properties of triethoxy(nonyl)silane;hydrofluoride?
triethoxy(nonyl)silane;hydrofluoride has a molecular weight of 310.53 g/mol, XLogP of 4.94, 14 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for triethoxy(nonyl)silane;hydrofluoride is sourced from PubChem (CID 161088856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).