About tetraethyl silicate;triethoxy(octyl)silane
tetraethyl silicate;triethoxy(octyl)silane (PubChem CID 174926814) has the molecular formula C22H52O7Si2
and a molecular weight of 484.82 g/mol. Its IUPAC name is tetraethyl silicate;triethoxy(octyl)silane.
Molecular Properties
| Compound Name | tetraethyl silicate;triethoxy(octyl)silane |
| PubChem CID | 174926814 |
| Molecular Formula | C22H52O7Si2 |
| Molecular Weight | 484.82 g/mol |
| Exact Mass | 484.33 |
| IUPAC Name | tetraethyl silicate;triethoxy(octyl)silane |
| SMILES | CCCCCCCC[Si](OCC)(OCC)OCC.CCO[Si](OCC)(OCC)OCC |
| InChI | InChI=1S/C14H32O3Si.C8H20O4Si/c1-5-9-10-11-12-13-14-18(15-6-2,16-7-3)17-8-4;1-5-9-13(10-6-2,11-7-3)12-8-4/h5-14H2,1-4H3;5-8H2,1-4H3 |
| InChIKey | UQXMSJYVEFPNBL-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 484.82 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tetraethyl silicate;triethoxy(octyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetraethyl silicate;triethoxy(octyl)silane?
The IUPAC name of tetraethyl silicate;triethoxy(octyl)silane (CID 174926814) is tetraethyl silicate;triethoxy(octyl)silane.
What is the SMILES notation for tetraethyl silicate;triethoxy(octyl)silane?
The canonical SMILES for tetraethyl silicate;triethoxy(octyl)silane is CCCCCCCC[Si](OCC)(OCC)OCC.CCO[Si](OCC)(OCC)OCC.
What is the InChIKey of tetraethyl silicate;triethoxy(octyl)silane?
The InChIKey is UQXMSJYVEFPNBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H32O3Si.C8H20O4Si/c1-5-9-10-11-12-13-14-18(15-6-2,16-7-3)17-8-4;1-5-9-13(10-6-2,11-7-3)12-8-4/h5-14H2,1-4H3;5-8H2,1-4H3.
What are the key properties of tetraethyl silicate;triethoxy(octyl)silane?
tetraethyl silicate;triethoxy(octyl)silane has a molecular weight of 484.82 g/mol, XLogP of 5.96, 21 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for tetraethyl silicate;triethoxy(octyl)silane is sourced from PubChem (CID 174926814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).